About ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate
ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate (PubChem CID 18183087) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate.
Analyze ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate?
The IUPAC name of ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate (CID 18183087) is ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate.
What is the SMILES notation for ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate?
The canonical SMILES for ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate is CCOC(=O)c1cn2c(n1)SCCC2.
What is the InChIKey of ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate?
The InChIKey is PPWLZLNTPVSKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-2-13-8(12)7-6-11-4-3-5-14-9(11)10-7/h6H,2-5H2,1H3.
What are the key properties of ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate?
ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate has a molecular weight of 212.27 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine-2-carboxylate is sourced from PubChem (CID 18183087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).