About 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide
6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide (PubChem CID 18183098) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide.
Analyze 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide?
The IUPAC name of 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide (CID 18183098) is 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide.
What is the SMILES notation for 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide?
The canonical SMILES for 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide is O=S1(=O)CCCn2ccnc21.
What is the InChIKey of 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide?
The InChIKey is AJZQHZJCDGSJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c9-11(10)5-1-3-8-4-2-7-6(8)11/h2,4H,1,3,5H2.
What are the key properties of 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide?
6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide has a molecular weight of 172.21 g/mol, XLogP of 0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazine 8,8-dioxide is sourced from PubChem (CID 18183098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).