C19H14FN3O2 — CID 18183177
9-(4-fluorophenyl)-6-methyl-13,15-dioxa-4,7,8-triazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaene (PubChem CID 18183177) has the molecular formula C19H14FN3O2 and a molecular weight of 335.34 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-6-methyl-13,15-dioxa-4,7,8-triazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaene.
| Compound Name | 9-(4-fluorophenyl)-6-methyl-13,15-dioxa-4,7,8-triazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaene |
|---|---|
| PubChem CID | 18183177 |
| Molecular Formula | C19H14FN3O2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 9-(4-fluorophenyl)-6-methyl-13,15-dioxa-4,7,8-triazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),3,5,8,10,12(16)-hexaene |
| SMILES | Cc1cnc2n1N=C(c1ccc(F)cc1)c1cc3c(cc1C2)OCO3 |
| InChI | InChI=1S/C19H14FN3O2/c1-11-9-21-18-7-13-6-16-17(25-10-24-16)8-15(13)19(22-23(11)18)12-2-4-14(20)5-3-12/h2-6,8-9H,7,10H2,1H3 |
| InChIKey | GEWDSQSJPRVFQT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |