About tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate
tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate (PubChem CID 18183242) has the molecular formula C18H20Cl2FN3O2
and a molecular weight of 400.28 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate |
| PubChem CID | 18183242 |
| Molecular Formula | C18H20Cl2FN3O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)c1ccc(-c2nc(Cl)ncc2Cl)cc1F |
| InChI | InChI=1S/C18H20Cl2FN3O2/c1-17(2,3)26-16(25)24-18(4,5)11-7-6-10(8-13(11)21)14-12(19)9-22-15(20)23-14/h6-9H,1-5H3,(H,24,25) |
| InChIKey | YFIKHZXGTDPCIR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate (CID 18183242) is tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate is CC(C)(C)OC(=O)NC(C)(C)c1ccc(-c2nc(Cl)ncc2Cl)cc1F.
What is the InChIKey of tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate?
The InChIKey is YFIKHZXGTDPCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2FN3O2/c1-17(2,3)26-16(25)24-18(4,5)11-7-6-10(8-13(11)21)14-12(19)9-22-15(20)23-14/h6-9H,1-5H3,(H,24,25).
What are the key properties of tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate?
tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate has a molecular weight of 400.28 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[4-(2,5-dichloropyrimidin-4-yl)-2-fluorophenyl]propan-2-yl]carbamate is sourced from PubChem (CID 18183242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).