C13H32N4 — CID 18183759
3-N,3-N,6-N,6-N,5-pentamethyloctane-3,4,4,6-tetramine (PubChem CID 18183759) has the molecular formula C13H32N4 and a molecular weight of 244.43 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N,5-pentamethyloctane-3,4,4,6-tetramine.
| Compound Name | 3-N,3-N,6-N,6-N,5-pentamethyloctane-3,4,4,6-tetramine |
|---|---|
| PubChem CID | 18183759 |
| Molecular Formula | C13H32N4 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.26 |
| IUPAC Name | 3-N,3-N,6-N,6-N,5-pentamethyloctane-3,4,4,6-tetramine |
| SMILES | CCC(C(C)C(N)(N)C(CC)N(C)C)N(C)C |
| InChI | InChI=1S/C13H32N4/c1-8-11(16(4)5)10(3)13(14,15)12(9-2)17(6)7/h10-12H,8-9,14-15H2,1-7H3 |
| InChIKey | MMTGMZLENNCYDD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|