About 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine
2-(2,4,5-trifluoro-3-methylphenyl)ethanamine (PubChem CID 18184170) has the molecular formula C9H10F3N
and a molecular weight of 189.18 g/mol. Its IUPAC name is 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine.
Molecular Properties
| Compound Name | 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine |
| PubChem CID | 18184170 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine |
| SMILES | Cc1c(F)c(F)cc(CCN)c1F |
| InChI | InChI=1S/C9H10F3N/c1-5-8(11)6(2-3-13)4-7(10)9(5)12/h4H,2-3,13H2,1H3 |
| InChIKey | LNPNNAXDFYPXQG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine?
The IUPAC name of 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine (CID 18184170) is 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine.
What is the SMILES notation for 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine?
The canonical SMILES for 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine is Cc1c(F)c(F)cc(CCN)c1F.
What is the InChIKey of 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine?
The InChIKey is LNPNNAXDFYPXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3N/c1-5-8(11)6(2-3-13)4-7(10)9(5)12/h4H,2-3,13H2,1H3.
What are the key properties of 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine?
2-(2,4,5-trifluoro-3-methylphenyl)ethanamine has a molecular weight of 189.18 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,5-trifluoro-3-methylphenyl)ethanamine is sourced from PubChem (CID 18184170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).