About N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride
N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride (PubChem CID 18184369) has the molecular formula C17H14BrClN4
and a molecular weight of 389.68 g/mol. Its IUPAC name is N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride |
| PubChem CID | 18184369 |
| Molecular Formula | C17H14BrClN4 |
| Molecular Weight | 389.68 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride |
| SMILES | Cl.Cn1c2ccccc2c2ncnc(Nc3cccc(Br)c3)c21 |
| InChI | InChI=1S/C17H13BrN4.ClH/c1-22-14-8-3-2-7-13(14)15-16(22)17(20-10-19-15)21-12-6-4-5-11(18)9-12;/h2-10H,1H3,(H,19,20,21);1H |
| InChIKey | VWTMQPAMTJLYMO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride?
The IUPAC name of N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride (CID 18184369) is N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride.
What is the SMILES notation for N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride?
The canonical SMILES for N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride is Cl.Cn1c2ccccc2c2ncnc(Nc3cccc(Br)c3)c21.
What is the InChIKey of N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride?
The InChIKey is VWTMQPAMTJLYMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrN4.ClH/c1-22-14-8-3-2-7-13(14)15-16(22)17(20-10-19-15)21-12-6-4-5-11(18)9-12;/h2-10H,1H3,(H,19,20,21);1H.
What are the key properties of N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride?
N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride has a molecular weight of 389.68 g/mol, XLogP of 5.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromophenyl)-5-methylpyrimido[5,4-b]indol-4-amine;hydrochloride is sourced from PubChem (CID 18184369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).