3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid

C10H18O3 — CID 18185142

IUPAC3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid
SMILESCC1(CO)CCC(C(=O)O)C1(C)C
InChIInChI=1S/C10H18O3/c1-9(2)7(8(12)13)4-5-10(9,3)6-11/h7,11H,4-6H2,1-3H3,(H,12,13)
InChIKeySCXPKNBRXGLPPW-UHFFFAOYSA-N
MW186.25 g/mol
LogP1.51
Rot. Bonds2

About 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid

3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid (PubChem CID 18185142) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid
PubChem CID18185142
Molecular FormulaC10H18O3
Molecular Weight186.25 g/mol
Exact Mass186.13
IUPAC Name3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid
SMILESCC1(CO)CCC(C(=O)O)C1(C)C
InChIInChI=1S/C10H18O3/c1-9(2)7(8(12)13)4-5-10(9,3)6-11/h7,11H,4-6H2,1-3H3,(H,12,13)
InChIKeySCXPKNBRXGLPPW-UHFFFAOYSA-N
XLogP1.51
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 51.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The IUPAC name of 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid (CID 18185142) is 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The canonical SMILES for 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid is CC1(CO)CCC(C(=O)O)C1(C)C.
What is the InChIKey of 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The InChIKey is SCXPKNBRXGLPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-9(2)7(8(12)13)4-5-10(9,3)6-11/h7,11H,4-6H2,1-3H3,(H,12,13).
What are the key properties of 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid?
3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid has a molecular weight of 186.25 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 18185142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).