C17H13F3N2O4S — CID 18185328
1-benzyl-5-(trifluoromethylsulfonylamino)indole-2-carboxylic acid (PubChem CID 18185328) has the molecular formula C17H13F3N2O4S and a molecular weight of 398.36 g/mol. Its IUPAC name is 1-benzyl-5-(trifluoromethylsulfonylamino)indole-2-carboxylic acid.
| Compound Name | 1-benzyl-5-(trifluoromethylsulfonylamino)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 18185328 |
| Molecular Formula | C17H13F3N2O4S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1-benzyl-5-(trifluoromethylsulfonylamino)indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(NS(=O)(=O)C(F)(F)F)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C17H13F3N2O4S/c18-17(19,20)27(25,26)21-13-6-7-14-12(8-13)9-15(16(23)24)22(14)10-11-4-2-1-3-5-11/h1-9,21H,10H2,(H,23,24) |
| InChIKey | JHBOLPQKOGXVPD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |