C17H19F3N2O4S — CID 18185364
1-(cyclohexylmethyl)-5-(trifluoromethylsulfonylamino)indole-2-carboxylic acid (PubChem CID 18185364) has the molecular formula C17H19F3N2O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-5-(trifluoromethylsulfonylamino)indole-2-carboxylic acid.
| Compound Name | 1-(cyclohexylmethyl)-5-(trifluoromethylsulfonylamino)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 18185364 |
| Molecular Formula | C17H19F3N2O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-(cyclohexylmethyl)-5-(trifluoromethylsulfonylamino)indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(NS(=O)(=O)C(F)(F)F)ccc2n1CC1CCCCC1 |
| InChI | InChI=1S/C17H19F3N2O4S/c18-17(19,20)27(25,26)21-13-6-7-14-12(8-13)9-15(16(23)24)22(14)10-11-4-2-1-3-5-11/h6-9,11,21H,1-5,10H2,(H,23,24) |
| InChIKey | YOPCIRQVZVWKEZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |