About but-3-en-2-amine;hydrochloride
but-3-en-2-amine;hydrochloride (PubChem CID 18185425) has the molecular formula C4H10ClN
and a molecular weight of 107.58 g/mol. Its IUPAC name is but-3-en-2-amine;hydrochloride.
Molecular Properties
| Compound Name | but-3-en-2-amine;hydrochloride |
| PubChem CID | 18185425 |
| Molecular Formula | C4H10ClN |
| Molecular Weight | 107.58 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | but-3-en-2-amine;hydrochloride |
| SMILES | C=CC(C)N.Cl |
| InChI | InChI=1S/C4H9N.ClH/c1-3-4(2)5;/h3-4H,1,5H2,2H3;1H |
| InChIKey | HRJVNHUMBUVTND-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.58 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-amine;hydrochloride?
The IUPAC name of but-3-en-2-amine;hydrochloride (CID 18185425) is but-3-en-2-amine;hydrochloride.
What is the SMILES notation for but-3-en-2-amine;hydrochloride?
The canonical SMILES for but-3-en-2-amine;hydrochloride is C=CC(C)N.Cl.
What is the InChIKey of but-3-en-2-amine;hydrochloride?
The InChIKey is HRJVNHUMBUVTND-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.ClH/c1-3-4(2)5;/h3-4H,1,5H2,2H3;1H.
What are the key properties of but-3-en-2-amine;hydrochloride?
but-3-en-2-amine;hydrochloride has a molecular weight of 107.58 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-amine;hydrochloride is sourced from PubChem (CID 18185425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).