About pent-4-en-2-amine;hydrochloride
pent-4-en-2-amine;hydrochloride (PubChem CID 18185429) has the molecular formula C5H12ClN
and a molecular weight of 121.61 g/mol. Its IUPAC name is pent-4-en-2-amine;hydrochloride.
Molecular Properties
| Compound Name | pent-4-en-2-amine;hydrochloride |
| PubChem CID | 18185429 |
| Molecular Formula | C5H12ClN |
| Molecular Weight | 121.61 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | pent-4-en-2-amine;hydrochloride |
| SMILES | C=CCC(C)N.Cl |
| InChI | InChI=1S/C5H11N.ClH/c1-3-4-5(2)6;/h3,5H,1,4,6H2,2H3;1H |
| InChIKey | PBKZSPFYOORUPB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.61 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-4-en-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-en-2-amine;hydrochloride?
The IUPAC name of pent-4-en-2-amine;hydrochloride (CID 18185429) is pent-4-en-2-amine;hydrochloride.
What is the SMILES notation for pent-4-en-2-amine;hydrochloride?
The canonical SMILES for pent-4-en-2-amine;hydrochloride is C=CCC(C)N.Cl.
What is the InChIKey of pent-4-en-2-amine;hydrochloride?
The InChIKey is PBKZSPFYOORUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.ClH/c1-3-4-5(2)6;/h3,5H,1,4,6H2,2H3;1H.
What are the key properties of pent-4-en-2-amine;hydrochloride?
pent-4-en-2-amine;hydrochloride has a molecular weight of 121.61 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-en-2-amine;hydrochloride is sourced from PubChem (CID 18185429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).