C9H4Cl4F3NO — CID 18185820
3,4,5-trichloro-N-(1-chloro-2,2,2-trifluoroethyl)benzamide (PubChem CID 18185820) has the molecular formula C9H4Cl4F3NO and a molecular weight of 340.94 g/mol. Its IUPAC name is 3,4,5-trichloro-N-(1-chloro-2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3,4,5-trichloro-N-(1-chloro-2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 18185820 |
| Molecular Formula | C9H4Cl4F3NO |
| Molecular Weight | 340.94 g/mol |
| Exact Mass | 338.90 |
| IUPAC Name | 3,4,5-trichloro-N-(1-chloro-2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NC(Cl)C(F)(F)F)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H4Cl4F3NO/c10-4-1-3(2-5(11)6(4)12)7(18)17-8(13)9(14,15)16/h1-2,8H,(H,17,18) |
| InChIKey | QCSCJTFTXMDXPJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.94 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|