About 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine
3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine (PubChem CID 18185948) has the molecular formula C12H25NS
and a molecular weight of 215.41 g/mol. Its IUPAC name is 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine |
| PubChem CID | 18185948 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine |
| SMILES | CCC(C)N1CC(C)(C)SC1C(C)C |
| InChI | InChI=1S/C12H25NS/c1-7-10(4)13-8-12(5,6)14-11(13)9(2)3/h9-11H,7-8H2,1-6H3 |
| InChIKey | DDMIYTGCBJTSOZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine?
The IUPAC name of 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine (CID 18185948) is 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine.
What is the SMILES notation for 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine?
The canonical SMILES for 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine is CCC(C)N1CC(C)(C)SC1C(C)C.
What is the InChIKey of 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine?
The InChIKey is DDMIYTGCBJTSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NS/c1-7-10(4)13-8-12(5,6)14-11(13)9(2)3/h9-11H,7-8H2,1-6H3.
What are the key properties of 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine?
3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine has a molecular weight of 215.41 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-5,5-dimethyl-2-propan-2-yl-1,3-thiazolidine is sourced from PubChem (CID 18185948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).