About 4-Methylfuran-2,3-dione
4-Methylfuran-2,3-dione (PubChem CID 18185992) has the molecular formula C5H4O3
and a molecular weight of 112.08 g/mol. Its IUPAC name is 4-methylfuran-2,3-dione.
Molecular Properties
| Compound Name | 4-Methylfuran-2,3-dione |
| PubChem CID | 18185992 |
| Molecular Formula | C5H4O3 |
| Molecular Weight | 112.08 g/mol |
| Exact Mass | 112.02 |
| IUPAC Name | 4-methylfuran-2,3-dione |
| SMILES | CC1=COC(=O)C1=O |
| InChI | InChI=1S/C5H4O3/c1-3-2-8-5(7)4(3)6/h2H,1H3 |
| InChIKey | CXNNFUZAYYCMMA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 178 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.08 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-Methylfuran-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Methylfuran-2,3-dione?
The IUPAC name of 4-Methylfuran-2,3-dione (CID 18185992) is 4-methylfuran-2,3-dione.
What is the SMILES notation for 4-Methylfuran-2,3-dione?
The canonical SMILES for 4-Methylfuran-2,3-dione is CC1=COC(=O)C1=O.
What is the InChIKey of 4-Methylfuran-2,3-dione?
The InChIKey is CXNNFUZAYYCMMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O3/c1-3-2-8-5(7)4(3)6/h2H,1H3.
What are the key properties of 4-Methylfuran-2,3-dione?
4-Methylfuran-2,3-dione has a molecular weight of 112.08 g/mol, XLogP of 0.20, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Methylfuran-2,3-dione is sourced from PubChem (CID 18185992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).