C14H30N6 — CID 18186117
3,10-bis(prop-2-enyl)-1,3,5,8,10,12-hexazacyclotetradecane (PubChem CID 18186117) has the molecular formula C14H30N6 and a molecular weight of 282.44 g/mol. Its IUPAC name is 3,10-bis(prop-2-enyl)-1,3,5,8,10,12-hexazacyclotetradecane.
| Compound Name | 3,10-bis(prop-2-enyl)-1,3,5,8,10,12-hexazacyclotetradecane |
|---|---|
| PubChem CID | 18186117 |
| Molecular Formula | C14H30N6 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.25 |
| IUPAC Name | 3,10-bis(prop-2-enyl)-1,3,5,8,10,12-hexazacyclotetradecane |
| SMILES | C=CCN1CNCCNCN(CC=C)CNCCNC1 |
| InChI | InChI=1S/C14H30N6/c1-3-9-19-11-15-5-7-17-13-20(10-4-2)14-18-8-6-16-12-19/h3-4,15-18H,1-2,5-14H2 |
| InChIKey | LHGQXRVPPLRMDD-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|