About 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene
1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene (PubChem CID 18186137) has the molecular formula C6H10Cl4
and a molecular weight of 223.96 g/mol. Its IUPAC name is 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene.
Molecular Properties
| Compound Name | 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene |
| PubChem CID | 18186137 |
| Molecular Formula | C6H10Cl4 |
| Molecular Weight | 223.96 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene |
| SMILES | CC(Cl)CCl.Cl/C=C/CCl |
| InChI | InChI=1S/C3H6Cl2.C3H4Cl2/c1-3(5)2-4;4-2-1-3-5/h3H,2H2,1H3;1-2H,3H2/b;2-1+ |
| InChIKey | FLWMCWWTXIAPAH-WLHGVMLRSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.96 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene?
The IUPAC name of 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene (CID 18186137) is 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene.
What is the SMILES notation for 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene?
The canonical SMILES for 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene is CC(Cl)CCl.Cl/C=C/CCl.
What is the InChIKey of 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene?
The InChIKey is FLWMCWWTXIAPAH-WLHGVMLRSA-N. The full InChI is InChI=1S/C3H6Cl2.C3H4Cl2/c1-3(5)2-4;4-2-1-3-5/h3H,2H2,1H3;1-2H,3H2/b;2-1+.
What are the key properties of 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene?
1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene has a molecular weight of 223.96 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloropropane;(E)-1,3-dichloroprop-1-ene is sourced from PubChem (CID 18186137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).