C27H42O3 — CID 18186230
(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) 3-cyclopentylpropanoate (PubChem CID 18186230) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is (10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) 3-cyclopentylpropanoate.
| Compound Name | (10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 18186230 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | (10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) 3-cyclopentylpropanoate |
| SMILES | CC12CCC(=O)CC1CCC1C2CCC2(C)C(OC(=O)CCC3CCCC3)CCC12 |
| InChI | InChI=1S/C27H42O3/c1-26-15-13-20(28)17-19(26)8-9-21-22-10-11-24(27(22,2)16-14-23(21)26)30-25(29)12-7-18-5-3-4-6-18/h18-19,21-24H,3-17H2,1-2H3 |
| InChIKey | WNURNPRHPSROBT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |