About 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide
1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide (PubChem CID 18186700) has the molecular formula C15H20N4O4
and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 18186700 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide |
| SMILES | CC(C)CC(C(=O)NCC#N)C1(C(N)=O)C=CC=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O4/c1-10(2)9-11(13(20)18-8-7-16)15(14(17)21)6-4-3-5-12(15)19(22)23/h3-6,10-12H,8-9H2,1-2H3,(H2,17,21)(H,18,20) |
| InChIKey | QTORQUSUNYSTLJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide (CID 18186700) is 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide is CC(C)CC(C(=O)NCC#N)C1(C(N)=O)C=CC=CC1[N+](=O)[O-].
What is the InChIKey of 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide?
The InChIKey is QTORQUSUNYSTLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O4/c1-10(2)9-11(13(20)18-8-7-16)15(14(17)21)6-4-3-5-12(15)19(22)23/h3-6,10-12H,8-9H2,1-2H3,(H2,17,21)(H,18,20).
What are the key properties of 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide?
1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide has a molecular weight of 320.35 g/mol, XLogP of 0.53, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-6-nitrocyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 18186700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).