C19H19ClFNO3S — CID 18187061
9-(4-chloro-3-fluorophenyl)-7,7-dimethyl-1,1-dioxo-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one (PubChem CID 18187061) has the molecular formula C19H19ClFNO3S and a molecular weight of 395.88 g/mol. Its IUPAC name is 9-(4-chloro-3-fluorophenyl)-7,7-dimethyl-1,1-dioxo-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one.
| Compound Name | 9-(4-chloro-3-fluorophenyl)-7,7-dimethyl-1,1-dioxo-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 18187061 |
| Molecular Formula | C19H19ClFNO3S |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 9-(4-chloro-3-fluorophenyl)-7,7-dimethyl-1,1-dioxo-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
| SMILES | CC1(C)CCC2=C(C1=O)C(c1ccc(Cl)c(F)c1)C1=C(CCS1(=O)=O)N2 |
| InChI | InChI=1S/C19H19ClFNO3S/c1-19(2)7-5-13-16(18(19)23)15(10-3-4-11(20)12(21)9-10)17-14(22-13)6-8-26(17,24)25/h3-4,9,15,22H,5-8H2,1-2H3 |
| InChIKey | NPIZTBRSZITLLJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |