C20H20F3NO3S — CID 18187082
9-[2-hydroxy-5-(trifluoromethoxy)phenyl]-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one (PubChem CID 18187082) has the molecular formula C20H20F3NO3S and a molecular weight of 411.45 g/mol. Its IUPAC name is 9-[2-hydroxy-5-(trifluoromethoxy)phenyl]-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one.
| Compound Name | 9-[2-hydroxy-5-(trifluoromethoxy)phenyl]-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 18187082 |
| Molecular Formula | C20H20F3NO3S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 9-[2-hydroxy-5-(trifluoromethoxy)phenyl]-7,7-dimethyl-2,3,4,5,6,9-hexahydrothieno[3,2-b]quinolin-8-one |
| SMILES | CC1(C)CCC2=C(C1=O)C(c1cc(OC(F)(F)F)ccc1O)C1=C(CCS1)N2 |
| InChI | InChI=1S/C20H20F3NO3S/c1-19(2)7-5-12-16(18(19)26)15(17-13(24-12)6-8-28-17)11-9-10(3-4-14(11)25)27-20(21,22)23/h3-4,9,15,24-25H,5-8H2,1-2H3 |
| InChIKey | CXKFPSPRRUEZIS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |