C14H13N — CID 18187422
4-azatricyclo[9.4.0.03,8]pentadeca-1,4,6,10,12,14-hexaene (PubChem CID 18187422) has the molecular formula C14H13N and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-azatricyclo[9.4.0.03,8]pentadeca-1,4,6,10,12,14-hexaene.
| Compound Name | 4-azatricyclo[9.4.0.03,8]pentadeca-1,4,6,10,12,14-hexaene |
|---|---|
| PubChem CID | 18187422 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 4-azatricyclo[9.4.0.03,8]pentadeca-1,4,6,10,12,14-hexaene |
| SMILES | C1=CC2CC=c3ccccc3=CC2N=C1 |
| InChI | InChI=1S/C14H13N/c1-2-5-13-10-14-12(6-3-9-15-14)8-7-11(13)4-1/h1-7,9-10,12,14H,8H2 |
| InChIKey | PZRIQVGIYBBULR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |