C16H17N3S — CID 18187788
3-[(5-piperidin-4-yl-1,3-thiazol-2-yl)methyl]benzonitrile (PubChem CID 18187788) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-[(5-piperidin-4-yl-1,3-thiazol-2-yl)methyl]benzonitrile.
| Compound Name | 3-[(5-piperidin-4-yl-1,3-thiazol-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 18187788 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-[(5-piperidin-4-yl-1,3-thiazol-2-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cc2ncc(C3CCNCC3)s2)c1 |
| InChI | InChI=1S/C16H17N3S/c17-10-13-3-1-2-12(8-13)9-16-19-11-15(20-16)14-4-6-18-7-5-14/h1-3,8,11,14,18H,4-7,9H2 |
| InChIKey | QCNVIFIFKJZYDK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |