About benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate
benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate (PubChem CID 18187860) has the molecular formula C22H25F2NO2
and a molecular weight of 373.44 g/mol. Its IUPAC name is benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate |
| PubChem CID | 18187860 |
| Molecular Formula | C22H25F2NO2 |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(CCC(F)(F)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25F2NO2/c23-22(24,20-9-5-2-6-10-20)14-11-18-12-15-25(16-13-18)21(26)27-17-19-7-3-1-4-8-19/h1-10,18H,11-17H2 |
| InChIKey | XNIZRSRLYZYILV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate?
The IUPAC name of benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate (CID 18187860) is benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate.
What is the SMILES notation for benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate?
The canonical SMILES for benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate is O=C(OCc1ccccc1)N1CCC(CCC(F)(F)c2ccccc2)CC1.
What is the InChIKey of benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate?
The InChIKey is XNIZRSRLYZYILV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F2NO2/c23-22(24,20-9-5-2-6-10-20)14-11-18-12-15-25(16-13-18)21(26)27-17-19-7-3-1-4-8-19/h1-10,18H,11-17H2.
What are the key properties of benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate?
benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate has a molecular weight of 373.44 g/mol, XLogP of 5.61, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(3,3-difluoro-3-phenylpropyl)piperidine-1-carboxylate is sourced from PubChem (CID 18187860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).