About indeno[1,2-c]pyrazole
indeno[1,2-c]pyrazole (PubChem CID 18188234) has the molecular formula C10H6N2
and a molecular weight of 154.17 g/mol. Its IUPAC name is indeno[1,2-c]pyrazole.
Molecular Properties
| Compound Name | indeno[1,2-c]pyrazole |
| PubChem CID | 18188234 |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | indeno[1,2-c]pyrazole |
| SMILES | C1=C2C=c3ccccc3=C2N=N1 |
| InChI | InChI=1S/C10H6N2/c1-2-4-9-7(3-1)5-8-6-11-12-10(8)9/h1-6H |
| InChIKey | XALCHIQGBKVSTD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indeno[1,2-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[1,2-c]pyrazole?
The IUPAC name of indeno[1,2-c]pyrazole (CID 18188234) is indeno[1,2-c]pyrazole.
What is the SMILES notation for indeno[1,2-c]pyrazole?
The canonical SMILES for indeno[1,2-c]pyrazole is C1=C2C=c3ccccc3=C2N=N1.
What is the InChIKey of indeno[1,2-c]pyrazole?
The InChIKey is XALCHIQGBKVSTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2/c1-2-4-9-7(3-1)5-8-6-11-12-10(8)9/h1-6H.
What are the key properties of indeno[1,2-c]pyrazole?
indeno[1,2-c]pyrazole has a molecular weight of 154.17 g/mol, XLogP of 0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[1,2-c]pyrazole is sourced from PubChem (CID 18188234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).