C16H19N5O2 — CID 18188258
1-(dimethylamino)-3-(4-oxo-3-propan-2-yl-2H-indeno[1,2-c]pyrazol-5-yl)urea (PubChem CID 18188258) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-(dimethylamino)-3-(4-oxo-3-propan-2-yl-2H-indeno[1,2-c]pyrazol-5-yl)urea.
| Compound Name | 1-(dimethylamino)-3-(4-oxo-3-propan-2-yl-2H-indeno[1,2-c]pyrazol-5-yl)urea |
|---|---|
| PubChem CID | 18188258 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(dimethylamino)-3-(4-oxo-3-propan-2-yl-2H-indeno[1,2-c]pyrazol-5-yl)urea |
| SMILES | CC(C)c1[nH]nc2c1C(=O)c1c(NC(=O)NN(C)C)cccc1-2 |
| InChI | InChI=1S/C16H19N5O2/c1-8(2)13-12-14(19-18-13)9-6-5-7-10(11(9)15(12)22)17-16(23)20-21(3)4/h5-8H,1-4H3,(H,18,19)(H2,17,20,23) |
| InChIKey | JFCAWDWLFIOXGJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|