About 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide
2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide (PubChem CID 18188385) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide.
Molecular Properties
| Compound Name | 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide |
| PubChem CID | 18188385 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)N(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C10H15NO3/c1-7(2)10(12)11(3-8-5-13-8)4-9-6-14-9/h8-9H,1,3-6H2,2H3 |
| InChIKey | SXXWNCNXSWHLQO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 45.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide?
The IUPAC name of 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide (CID 18188385) is 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide.
What is the SMILES notation for 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide?
The canonical SMILES for 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide is C=C(C)C(=O)N(CC1CO1)CC1CO1.
What is the InChIKey of 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide?
The InChIKey is SXXWNCNXSWHLQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-7(2)10(12)11(3-8-5-13-8)4-9-6-14-9/h8-9H,1,3-6H2,2H3.
What are the key properties of 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide?
2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide has a molecular weight of 197.23 g/mol, XLogP of 0.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N-bis(oxiran-2-ylmethyl)prop-2-enamide is sourced from PubChem (CID 18188385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).