C68H88 — CID 18188427
1,2,3,4-tetrakis(2,4-ditert-butylphenyl)biphenylene (PubChem CID 18188427) has the molecular formula C68H88 and a molecular weight of 905.45 g/mol. Its IUPAC name is 1,2,3,4-tetrakis(2,4-ditert-butylphenyl)biphenylene.
| Compound Name | 1,2,3,4-tetrakis(2,4-ditert-butylphenyl)biphenylene |
|---|---|
| PubChem CID | 18188427 |
| Molecular Formula | C68H88 |
| Molecular Weight | 905.45 g/mol |
| Exact Mass | 904.69 |
| IUPAC Name | 1,2,3,4-tetrakis(2,4-ditert-butylphenyl)biphenylene |
| SMILES | CC(C)(C)c1ccc(-c2c(-c3ccc(C(C)(C)C)cc3C(C)(C)C)c(-c3ccc(C(C)(C)C)cc3C(C)(C)C)c3c(c2-c2ccc(C(C)(C)C)cc2C(C)(C)C)=c2ccccc2=3)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H88/c1-61(2,3)41-29-33-47(51(37-41)65(13,14)15)57-55-45-27-25-26-28-46(45)56(55)58(48-34-30-42(62(4,5)6)38-52(48)66(16,17)18)60(50-36-32-44(64(10,11)12)40-54(50)68(22,23)24)59(57)49-35-31-43(63(7,8)9)39-53(49)67(19,20)21/h25-40H,1-24H3 |
| InChIKey | NVWZUUBHBWBVAE-UHFFFAOYSA-N |
| XLogP | 19.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.45 |
| LogP ≤ 5 | 19.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |