bis(1,1'-biphenyl);phosphenous acid

C24H21O2P — CID 18188455

IUPACbis(1,1'-biphenyl);phosphenous acid
SMILESO=PO.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/2C12H10.HO2P/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h2*1-10H;(H,1,2)
InChIKeyOSYDLUIEFKQFGS-UHFFFAOYSA-N
MW372.40 g/mol
LogP6.89
Rot. Bonds2

About bis(1,1'-biphenyl);phosphenous acid

bis(1,1'-biphenyl);phosphenous acid (PubChem CID 18188455) has the molecular formula C24H21O2P and a molecular weight of 372.40 g/mol. Its IUPAC name is bis(1,1'-biphenyl);phosphenous acid.

Molecular Properties

Compound Namebis(1,1'-biphenyl);phosphenous acid
PubChem CID18188455
Molecular FormulaC24H21O2P
Molecular Weight372.40 g/mol
Exact Mass372.13
IUPAC Namebis(1,1'-biphenyl);phosphenous acid
SMILESO=PO.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/2C12H10.HO2P/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h2*1-10H;(H,1,2)
InChIKeyOSYDLUIEFKQFGS-UHFFFAOYSA-N
XLogP6.89
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500372.40
LogP ≤ 56.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze bis(1,1'-biphenyl);phosphenous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(1,1'-biphenyl);phosphenous acid?
The IUPAC name of bis(1,1'-biphenyl);phosphenous acid (CID 18188455) is bis(1,1'-biphenyl);phosphenous acid.
What is the SMILES notation for bis(1,1'-biphenyl);phosphenous acid?
The canonical SMILES for bis(1,1'-biphenyl);phosphenous acid is O=PO.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of bis(1,1'-biphenyl);phosphenous acid?
The InChIKey is OSYDLUIEFKQFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10.HO2P/c2*1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h2*1-10H;(H,1,2).
What are the key properties of bis(1,1'-biphenyl);phosphenous acid?
bis(1,1'-biphenyl);phosphenous acid has a molecular weight of 372.40 g/mol, XLogP of 6.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,1'-biphenyl);phosphenous acid is sourced from PubChem (CID 18188455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).