C28H31F2NO9S — CID 18188641
[1-(difluoromethoxy)-6-(3,4-dimethoxyphenyl)-2-[2-(2-methoxyethoxy)ethoxy]-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 18188641) has the molecular formula C28H31F2NO9S and a molecular weight of 595.62 g/mol. Its IUPAC name is [1-(difluoromethoxy)-6-(3,4-dimethoxyphenyl)-2-[2-(2-methoxyethoxy)ethoxy]-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | [1-(difluoromethoxy)-6-(3,4-dimethoxyphenyl)-2-[2-(2-methoxyethoxy)ethoxy]-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18188641 |
| Molecular Formula | C28H31F2NO9S |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.17 |
| IUPAC Name | [1-(difluoromethoxy)-6-(3,4-dimethoxyphenyl)-2-[2-(2-methoxyethoxy)ethoxy]-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | COCCOCCOc1ccc2c(c1OC(F)F)-c1ccc(CS(N)(=O)=O)cc1C(c1ccc(OC)c(OC)c1)O2 |
| InChI | InChI=1S/C28H31F2NO9S/c1-34-10-11-37-12-13-38-23-9-8-22-25(27(23)40-28(29)30)19-6-4-17(16-41(31,32)33)14-20(19)26(39-22)18-5-7-21(35-2)24(15-18)36-3/h4-9,14-15,26,28H,10-13,16H2,1-3H3,(H2,31,32,33) |
| InChIKey | MDOCEGWTQVJPBY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|