C26H26F3NO7S — CID 18188965
[1-(difluoromethoxy)-6-(3-fluorophenyl)-2-[2-(2-methoxyethoxy)ethoxy]-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 18188965) has the molecular formula C26H26F3NO7S and a molecular weight of 553.56 g/mol. Its IUPAC name is [1-(difluoromethoxy)-6-(3-fluorophenyl)-2-[2-(2-methoxyethoxy)ethoxy]-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | [1-(difluoromethoxy)-6-(3-fluorophenyl)-2-[2-(2-methoxyethoxy)ethoxy]-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18188965 |
| Molecular Formula | C26H26F3NO7S |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | [1-(difluoromethoxy)-6-(3-fluorophenyl)-2-[2-(2-methoxyethoxy)ethoxy]-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | COCCOCCOc1ccc2c(c1OC(F)F)-c1ccc(CS(N)(=O)=O)cc1C(c1cccc(F)c1)O2 |
| InChI | InChI=1S/C26H26F3NO7S/c1-33-9-10-34-11-12-35-22-8-7-21-23(25(22)37-26(28)29)19-6-5-16(15-38(30,31)32)13-20(19)24(36-21)17-3-2-4-18(27)14-17/h2-8,13-14,24,26H,9-12,15H2,1H3,(H2,30,31,32) |
| InChIKey | YFAVTQLVULLMBJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|