About 4-acetamidobutanoic acid
4-acetamidobutanoic acid (PubChem CID 18189) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 4-acetamidobutanoic acid.
Molecular Properties
| Compound Name | 4-acetamidobutanoic acid |
| PubChem CID | 18189 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 4-acetamidobutanoic acid |
| SMILES | CC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-5(8)7-4-2-3-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | UZTFMUBKZQVKLK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-acetamidobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetamidobutanoic acid?
The IUPAC name of 4-acetamidobutanoic acid (CID 18189) is 4-acetamidobutanoic acid.
What is the SMILES notation for 4-acetamidobutanoic acid?
The canonical SMILES for 4-acetamidobutanoic acid is CC(=O)NCCCC(=O)O.
What is the InChIKey of 4-acetamidobutanoic acid?
The InChIKey is UZTFMUBKZQVKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-5(8)7-4-2-3-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10).
What are the key properties of 4-acetamidobutanoic acid?
4-acetamidobutanoic acid has a molecular weight of 145.16 g/mol, XLogP of -0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetamidobutanoic acid is sourced from PubChem (CID 18189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).