About [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide
[6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 18189093) has the molecular formula C23H23NO6S
and a molecular weight of 441.51 g/mol. Its IUPAC name is [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| PubChem CID | 18189093 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | COc1ccc(C2Oc3cccc(CO)c3-c3ccc(CS(N)(=O)=O)cc32)cc1OC |
| InChI | InChI=1S/C23H23NO6S/c1-28-19-9-7-15(11-21(19)29-2)23-18-10-14(13-31(24,26)27)6-8-17(18)22-16(12-25)4-3-5-20(22)30-23/h3-11,23,25H,12-13H2,1-2H3,(H2,24,26,27) |
| InChIKey | LXCGAWYKOLVGJW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide?
The IUPAC name of [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide (CID 18189093) is [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide.
What is the SMILES notation for [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide?
The canonical SMILES for [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide is COc1ccc(C2Oc3cccc(CO)c3-c3ccc(CS(N)(=O)=O)cc32)cc1OC.
What is the InChIKey of [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide?
The InChIKey is LXCGAWYKOLVGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO6S/c1-28-19-9-7-15(11-21(19)29-2)23-18-10-14(13-31(24,26)27)6-8-17(18)22-16(12-25)4-3-5-20(22)30-23/h3-11,23,25H,12-13H2,1-2H3,(H2,24,26,27).
What are the key properties of [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide?
[6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide has a molecular weight of 441.51 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(3,4-dimethoxyphenyl)-1-(hydroxymethyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide is sourced from PubChem (CID 18189093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).