C28H29F2NO8S — CID 18189303
[1-(difluoromethoxy)-6-(3,4-dimethoxyphenyl)-2-(2-prop-2-enoxyethoxy)-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 18189303) has the molecular formula C28H29F2NO8S and a molecular weight of 577.60 g/mol. Its IUPAC name is [1-(difluoromethoxy)-6-(3,4-dimethoxyphenyl)-2-(2-prop-2-enoxyethoxy)-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | [1-(difluoromethoxy)-6-(3,4-dimethoxyphenyl)-2-(2-prop-2-enoxyethoxy)-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18189303 |
| Molecular Formula | C28H29F2NO8S |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | [1-(difluoromethoxy)-6-(3,4-dimethoxyphenyl)-2-(2-prop-2-enoxyethoxy)-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | C=CCOCCOc1ccc2c(c1OC(F)F)-c1ccc(CS(N)(=O)=O)cc1C(c1ccc(OC)c(OC)c1)O2 |
| InChI | InChI=1S/C28H29F2NO8S/c1-4-11-36-12-13-37-23-10-9-22-25(27(23)39-28(29)30)19-7-5-17(16-40(31,32)33)14-20(19)26(38-22)18-6-8-21(34-2)24(15-18)35-3/h4-10,14-15,26,28H,1,11-13,16H2,2-3H3,(H2,31,32,33) |
| InChIKey | DFSGDFVTOYFRTQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|