C17H16BrN3O2S — CID 18190050
N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-2-(3-methoxyphenyl)acetamide (PubChem CID 18190050) has the molecular formula C17H16BrN3O2S and a molecular weight of 406.31 g/mol. Its IUPAC name is N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18190050 |
| Molecular Formula | C17H16BrN3O2S |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-2-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(CC(=O)Nc2ccnn2Cc2cc(Br)cs2)c1 |
| InChI | InChI=1S/C17H16BrN3O2S/c1-23-14-4-2-3-12(7-14)8-17(22)20-16-5-6-19-21(16)10-15-9-13(18)11-24-15/h2-7,9,11H,8,10H2,1H3,(H,20,22) |
| InChIKey | UZLJYYXQICJGBX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |