C17H19N5O — CID 18191323
N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 18191323) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 18191323 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N,5-dimethyl-N-[(4-prop-2-enoxyphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=CCOc1ccc(CN(C)c2cc(C)nc3ncnn23)cc1 |
| InChI | InChI=1S/C17H19N5O/c1-4-9-23-15-7-5-14(6-8-15)11-21(3)16-10-13(2)20-17-18-12-19-22(16)17/h4-8,10,12H,1,9,11H2,2-3H3 |
| InChIKey | JXWUDGBMNPCQEI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|