C16H15FN2O2 — CID 18194975
4-(acetamidomethyl)-N-(3-fluorophenyl)benzamide (PubChem CID 18194975) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-(acetamidomethyl)-N-(3-fluorophenyl)benzamide.
| Compound Name | 4-(acetamidomethyl)-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 18194975 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-(acetamidomethyl)-N-(3-fluorophenyl)benzamide |
| SMILES | CC(=O)NCc1ccc(C(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C16H15FN2O2/c1-11(20)18-10-12-5-7-13(8-6-12)16(21)19-15-4-2-3-14(17)9-15/h2-9H,10H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | JOOQEDKQQBHWSK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |