C20H13N3O2S — CID 18197019
2-(furan-2-yl)-5-(phenanthridin-6-ylmethylsulfanyl)-1,3,4-oxadiazole (PubChem CID 18197019) has the molecular formula C20H13N3O2S and a molecular weight of 359.41 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-(phenanthridin-6-ylmethylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(furan-2-yl)-5-(phenanthridin-6-ylmethylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 18197019 |
| Molecular Formula | C20H13N3O2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-(furan-2-yl)-5-(phenanthridin-6-ylmethylsulfanyl)-1,3,4-oxadiazole |
| SMILES | c1coc(-c2nnc(SCc3nc4ccccc4c4ccccc34)o2)c1 |
| InChI | InChI=1S/C20H13N3O2S/c1-2-8-15-13(6-1)14-7-3-4-9-16(14)21-17(15)12-26-20-23-22-19(25-20)18-10-5-11-24-18/h1-11H,12H2 |
| InChIKey | DNTXWHMSTKLKQX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|