About [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate
[2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate (PubChem CID 18197053) has the molecular formula C20H25N3O4
and a molecular weight of 371.44 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate.
Molecular Properties
| Compound Name | [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate |
| PubChem CID | 18197053 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate |
| SMILES | CCCn1nc(C(=O)OCC(=O)N(C)Cc2ccc(C)cc2C)ccc1=O |
| InChI | InChI=1S/C20H25N3O4/c1-5-10-23-18(24)9-8-17(21-23)20(26)27-13-19(25)22(4)12-16-7-6-14(2)11-15(16)3/h6-9,11H,5,10,12-13H2,1-4H3 |
| InChIKey | YLGGGOCOANQVJX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate?
The IUPAC name of [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate (CID 18197053) is [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate.
What is the SMILES notation for [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate?
The canonical SMILES for [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate is CCCn1nc(C(=O)OCC(=O)N(C)Cc2ccc(C)cc2C)ccc1=O.
What is the InChIKey of [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate?
The InChIKey is YLGGGOCOANQVJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O4/c1-5-10-23-18(24)9-8-17(21-23)20(26)27-13-19(25)22(4)12-16-7-6-14(2)11-15(16)3/h6-9,11H,5,10,12-13H2,1-4H3.
What are the key properties of [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate?
[2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate has a molecular weight of 371.44 g/mol, XLogP of 2.09, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,4-dimethylphenyl)methyl-methylamino]-2-oxoethyl] 6-oxo-1-propylpyridazine-3-carboxylate is sourced from PubChem (CID 18197053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).