About 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one
7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 18199826) has the molecular formula C13H10ClN3OS2
and a molecular weight of 323.83 g/mol. Its IUPAC name is 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 18199826 |
| Molecular Formula | C13H10ClN3OS2 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1csc(SCc2cc(=O)n3cc(Cl)ccc3n2)n1 |
| InChI | InChI=1S/C13H10ClN3OS2/c1-8-6-19-13(15-8)20-7-10-4-12(18)17-5-9(14)2-3-11(17)16-10/h2-6H,7H2,1H3 |
| InChIKey | KEUZHLCKPUDFOD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one (CID 18199826) is 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one is Cc1csc(SCc2cc(=O)n3cc(Cl)ccc3n2)n1.
What is the InChIKey of 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is KEUZHLCKPUDFOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3OS2/c1-8-6-19-13(15-8)20-7-10-4-12(18)17-5-9(14)2-3-11(17)16-10/h2-6H,7H2,1H3.
What are the key properties of 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one?
7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 323.83 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 18199826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).