C22H33N3O3 — CID 18200139
1-[2-(tert-butylamino)-2-oxoethyl]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide (PubChem CID 18200139) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[2-(tert-butylamino)-2-oxoethyl]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide.
| Compound Name | 1-[2-(tert-butylamino)-2-oxoethyl]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 18200139 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-[2-(tert-butylamino)-2-oxoethyl]-N-(4-morpholin-4-ylphenyl)cyclopentane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)CC1(C(=O)Nc2ccc(N3CCOCC3)cc2)CCCC1 |
| InChI | InChI=1S/C22H33N3O3/c1-21(2,3)24-19(26)16-22(10-4-5-11-22)20(27)23-17-6-8-18(9-7-17)25-12-14-28-15-13-25/h6-9H,4-5,10-16H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | WJZGAOUVCMZJOM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|