C16H19N3OS — CID 18201005
2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-ethylpent-1-yn-3-yl)acetamide (PubChem CID 18201005) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-ethylpent-1-yn-3-yl)acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-ethylpent-1-yn-3-yl)acetamide |
|---|---|
| PubChem CID | 18201005 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(3-ethylpent-1-yn-3-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H19N3OS/c1-4-16(5-2,6-3)19-14(20)11-21-15-17-12-9-7-8-10-13(12)18-15/h1,7-10H,5-6,11H2,2-3H3,(H,17,18)(H,19,20) |
| InChIKey | YAKGQNVKKGJAIH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|