About (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate
(3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate (PubChem CID 18202613) has the molecular formula C20H14FN3O3S
and a molecular weight of 395.42 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate |
| PubChem CID | 18202613 |
| Molecular Formula | C20H14FN3O3S |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate |
| SMILES | COc1ccc(COC(=O)c2nccnc2-c2nc3ccccc3s2)cc1F |
| InChI | InChI=1S/C20H14FN3O3S/c1-26-15-7-6-12(10-13(15)21)11-27-20(25)18-17(22-8-9-23-18)19-24-14-4-2-3-5-16(14)28-19/h2-10H,11H2,1H3 |
| InChIKey | GCLATSGPSYUSBJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate?
The IUPAC name of (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate (CID 18202613) is (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate.
What is the SMILES notation for (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate?
The canonical SMILES for (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate is COc1ccc(COC(=O)c2nccnc2-c2nc3ccccc3s2)cc1F.
What is the InChIKey of (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate?
The InChIKey is GCLATSGPSYUSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FN3O3S/c1-26-15-7-6-12(10-13(15)21)11-27-20(25)18-17(22-8-9-23-18)19-24-14-4-2-3-5-16(14)28-19/h2-10H,11H2,1H3.
What are the key properties of (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate?
(3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate has a molecular weight of 395.42 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-4-methoxyphenyl)methyl 3-(1,3-benzothiazol-2-yl)pyrazine-2-carboxylate is sourced from PubChem (CID 18202613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).