C16H20ClN5O3S — CID 18202749
methyl 2-[[2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]-3-methylpentanoate (PubChem CID 18202749) has the molecular formula C16H20ClN5O3S and a molecular weight of 397.89 g/mol. Its IUPAC name is methyl 2-[[2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 18202749 |
| Molecular Formula | C16H20ClN5O3S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | methyl 2-[[2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)CSc1nnnn1-c1cccc(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C16H20ClN5O3S/c1-4-10(2)14(15(24)25-3)18-13(23)9-26-16-19-20-21-22(16)12-7-5-6-11(17)8-12/h5-8,10,14H,4,9H2,1-3H3,(H,18,23) |
| InChIKey | AHDAKEGDFWSGSZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |