C14H18N4O4S — CID 18203122
2-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 18203122) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 18203122 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | CCc1cc2c(=O)n(CC(=O)NC(=O)NCCOC)cnc2s1 |
| InChI | InChI=1S/C14H18N4O4S/c1-3-9-6-10-12(23-9)16-8-18(13(10)20)7-11(19)17-14(21)15-4-5-22-2/h6,8H,3-5,7H2,1-2H3,(H2,15,17,19,21) |
| InChIKey | LONOAHWMDKIMLJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|