C15H14BrFN2O3 — CID 18203648
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 4-bromo-1H-pyrrole-2-carboxylate (PubChem CID 18203648) has the molecular formula C15H14BrFN2O3 and a molecular weight of 369.19 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 4-bromo-1H-pyrrole-2-carboxylate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 4-bromo-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18203648 |
| Molecular Formula | C15H14BrFN2O3 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 4-bromo-1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(Br)c[nH]1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H14BrFN2O3/c16-11-7-13(19-8-11)15(21)22-9-14(20)18-6-5-10-1-3-12(17)4-2-10/h1-4,7-8,19H,5-6,9H2,(H,18,20) |
| InChIKey | MWHOGJLLPYDRBM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |