C16H12ClN3O3S — CID 18204125
(2-chloro-4-cyanophenyl) 2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 18204125) has the molecular formula C16H12ClN3O3S and a molecular weight of 361.81 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl) 2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | (2-chloro-4-cyanophenyl) 2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 18204125 |
| Molecular Formula | C16H12ClN3O3S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (2-chloro-4-cyanophenyl) 2-[2-(2-oxopyrrolidin-1-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | N#Cc1ccc(OC(=O)Cc2csc(N3CCCC3=O)n2)c(Cl)c1 |
| InChI | InChI=1S/C16H12ClN3O3S/c17-12-6-10(8-18)3-4-13(12)23-15(22)7-11-9-24-16(19-11)20-5-1-2-14(20)21/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | QEANKBVWLZYNCD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|