About N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide
N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 18205340) has the molecular formula C23H15FN4OS
and a molecular weight of 414.47 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide |
| PubChem CID | 18205340 |
| Molecular Formula | C23H15FN4OS |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1nc2ccc(F)cc2s1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H15FN4OS/c24-16-11-12-19-20(13-16)30-23(25-19)26-22(29)18-14-28(17-9-5-2-6-10-17)27-21(18)15-7-3-1-4-8-15/h1-14H,(H,25,26,29) |
| InChIKey | BCGLFSYECNRIGQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide?
The IUPAC name of N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide (CID 18205340) is N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide.
What is the SMILES notation for N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide?
The canonical SMILES for N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide is O=C(Nc1nc2ccc(F)cc2s1)c1cn(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide?
The InChIKey is BCGLFSYECNRIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15FN4OS/c24-16-11-12-19-20(13-16)30-23(25-19)26-22(29)18-14-28(17-9-5-2-6-10-17)27-21(18)15-7-3-1-4-8-15/h1-14H,(H,25,26,29).
What are the key properties of N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide?
N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide has a molecular weight of 414.47 g/mol, XLogP of 5.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-1,3-benzothiazol-2-yl)-1,3-diphenylpyrazole-4-carboxamide is sourced from PubChem (CID 18205340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).