C22H18FN3O2S2 — CID 18206568
3-amino-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 18206568) has the molecular formula C22H18FN3O2S2 and a molecular weight of 439.54 g/mol. Its IUPAC name is 3-amino-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-amino-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 18206568 |
| Molecular Formula | C22H18FN3O2S2 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 3-amino-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Nn1c(SCCCC(=O)c2ccc(F)cc2)nc2scc(-c3ccccc3)c2c1=O |
| InChI | InChI=1S/C22H18FN3O2S2/c23-16-10-8-15(9-11-16)18(27)7-4-12-29-22-25-20-19(21(28)26(22)24)17(13-30-20)14-5-2-1-3-6-14/h1-3,5-6,8-11,13H,4,7,12,24H2 |
| InChIKey | ZNPGCLOXMHGZMA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|