C21H24N4O4S — CID 18206623
1-[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 18206623) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18206623 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[2-(2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-2-oxoethyl]-3,5-bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)N2CCC(C)Sc3ccccc32)c1=O |
| InChI | InChI=1S/C21H24N4O4S/c1-4-11-23-19(27)24(12-5-2)21(29)25(20(23)28)14-18(26)22-13-10-15(3)30-17-9-7-6-8-16(17)22/h4-9,15H,1-2,10-14H2,3H3 |
| InChIKey | FBQGABONDVVGTF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|